About 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide
2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 77071608) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| PubChem CID | 77071608 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | CCC1CN(CC2(CC(N)=NO)CC2)CCO1 |
| InChI | InChI=1S/C12H23N3O2/c1-2-10-8-15(5-6-17-10)9-12(3-4-12)7-11(13)14-16/h10,16H,2-9H2,1H3,(H2,13,14) |
| InChIKey | RRXXCEKZTBAZRJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide (CID 77071608) is 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide is CCC1CN(CC2(CC(N)=NO)CC2)CCO1.
What is the InChIKey of 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
The InChIKey is RRXXCEKZTBAZRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O2/c1-2-10-8-15(5-6-17-10)9-12(3-4-12)7-11(13)14-16/h10,16H,2-9H2,1H3,(H2,13,14).
What are the key properties of 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide has a molecular weight of 241.33 g/mol, XLogP of 1.01, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2-ethylmorpholin-4-yl)methyl]cyclopropyl]-N'-hydroxyethanimidamide is sourced from PubChem (CID 77071608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).