C16H15NO3 — CID 7707174
4-[(3,5-dimethoxyphenoxy)methyl]benzonitrile (PubChem CID 7707174) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-[(3,5-dimethoxyphenoxy)methyl]benzonitrile.
| Compound Name | 4-[(3,5-dimethoxyphenoxy)methyl]benzonitrile |
|---|---|
| PubChem CID | 7707174 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-[(3,5-dimethoxyphenoxy)methyl]benzonitrile |
| SMILES | COc1cc(OC)cc(OCc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C16H15NO3/c1-18-14-7-15(19-2)9-16(8-14)20-11-13-5-3-12(10-17)4-6-13/h3-9H,11H2,1-2H3 |
| InChIKey | KULJQCWRBYAHCE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |