C14H14N4O2 — CID 77072600
N-[3-(N'-hydroxycarbamimidoyl)phenyl]-5-methylpyridine-3-carboxamide (PubChem CID 77072600) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is N-[3-(N'-hydroxycarbamimidoyl)phenyl]-5-methylpyridine-3-carboxamide.
| Compound Name | N-[3-(N'-hydroxycarbamimidoyl)phenyl]-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 77072600 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-[3-(N'-hydroxycarbamimidoyl)phenyl]-5-methylpyridine-3-carboxamide |
| SMILES | Cc1cncc(C(=O)Nc2cccc(C(N)=NO)c2)c1 |
| InChI | InChI=1S/C14H14N4O2/c1-9-5-11(8-16-7-9)14(19)17-12-4-2-3-10(6-12)13(15)18-20/h2-8,20H,1H3,(H2,15,18)(H,17,19) |
| InChIKey | CMXZCDCLVAIRNP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|