C10H14F3NO3 — CID 77073216
2,3-dimethyl-4-[methyl(3,3,3-trifluoropropyl)amino]-4-oxobut-2-enoic acid (PubChem CID 77073216) has the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. Its IUPAC name is 2,3-dimethyl-4-[methyl(3,3,3-trifluoropropyl)amino]-4-oxobut-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-[methyl(3,3,3-trifluoropropyl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 77073216 |
| Molecular Formula | C10H14F3NO3 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2,3-dimethyl-4-[methyl(3,3,3-trifluoropropyl)amino]-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C10H14F3NO3/c1-6(7(2)9(16)17)8(15)14(3)5-4-10(11,12)13/h4-5H2,1-3H3,(H,16,17) |
| InChIKey | MRXUDBPVDJPZOF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|