C9H11F3N2O4 — CID 77073313
4-[[methyl(3,3,3-trifluoropropyl)carbamoyl]amino]-4-oxobut-2-enoic acid (PubChem CID 77073313) has the molecular formula C9H11F3N2O4 and a molecular weight of 268.19 g/mol. Its IUPAC name is 4-[[methyl(3,3,3-trifluoropropyl)carbamoyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[methyl(3,3,3-trifluoropropyl)carbamoyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 77073313 |
| Molecular Formula | C9H11F3N2O4 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4-[[methyl(3,3,3-trifluoropropyl)carbamoyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CN(CCC(F)(F)F)C(=O)NC(=O)C=CC(=O)O |
| InChI | InChI=1S/C9H11F3N2O4/c1-14(5-4-9(10,11)12)8(18)13-6(15)2-3-7(16)17/h2-3H,4-5H2,1H3,(H,16,17)(H,13,15,18) |
| InChIKey | MHPCXILHBNBWKA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|