C10H13F3N4O — CID 77073333
N'-hydroxy-6-[methyl(3,3,3-trifluoropropyl)amino]pyridine-3-carboximidamide (PubChem CID 77073333) has the molecular formula C10H13F3N4O and a molecular weight of 262.24 g/mol. Its IUPAC name is N'-hydroxy-6-[methyl(3,3,3-trifluoropropyl)amino]pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-6-[methyl(3,3,3-trifluoropropyl)amino]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 77073333 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N'-hydroxy-6-[methyl(3,3,3-trifluoropropyl)amino]pyridine-3-carboximidamide |
| SMILES | CN(CCC(F)(F)F)c1ccc(C(N)=NO)cn1 |
| InChI | InChI=1S/C10H13F3N4O/c1-17(5-4-10(11,12)13)8-3-2-7(6-15-8)9(14)16-18/h2-3,6,18H,4-5H2,1H3,(H2,14,16) |
| InChIKey | AUBVNBGAPYEBQA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|