C11H16N4O2 — CID 77074035
methyl 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-methylbut-2-enoate (PubChem CID 77074035) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-methylbut-2-enoate.
| Compound Name | methyl 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 77074035 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | methyl 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCN1CCn2cnnc2C1 |
| InChI | InChI=1S/C11H16N4O2/c1-9(11(16)17-2)3-4-14-5-6-15-8-12-13-10(15)7-14/h3,8H,4-7H2,1-2H3 |
| InChIKey | JGRRRZRPQSGXIT-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|