methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate

C12H22N2O2 — CID 77074098

IUPACmethyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate
SMILESCOC(=O)C(C)=CCN1CCC(N(C)C)C1
InChIInChI=1S/C12H22N2O2/c1-10(12(15)16-4)5-7-14-8-6-11(9-14)13(2)3/h5,11H,6-9H2,1-4H3
InChIKeyJWOREPWMSMDURB-UHFFFAOYSA-N
MW226.32 g/mol
LogP0.74
Rot. Bonds4

About methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate

methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate (PubChem CID 77074098) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate.

Molecular Properties

Compound Namemethyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate
PubChem CID77074098
Molecular FormulaC12H22N2O2
Molecular Weight226.32 g/mol
Exact Mass226.17
IUPAC Namemethyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate
SMILESCOC(=O)C(C)=CCN1CCC(N(C)C)C1
InChIInChI=1S/C12H22N2O2/c1-10(12(15)16-4)5-7-14-8-6-11(9-14)13(2)3/h5,11H,6-9H2,1-4H3
InChIKeyJWOREPWMSMDURB-UHFFFAOYSA-N
XLogP0.74
TPSA32.78 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.32
LogP ≤ 50.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate?
The IUPAC name of methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate (CID 77074098) is methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate.
What is the SMILES notation for methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate?
The canonical SMILES for methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate is COC(=O)C(C)=CCN1CCC(N(C)C)C1.
What is the InChIKey of methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate?
The InChIKey is JWOREPWMSMDURB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-10(12(15)16-4)5-7-14-8-6-11(9-14)13(2)3/h5,11H,6-9H2,1-4H3.
What are the key properties of methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate?
methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate has a molecular weight of 226.32 g/mol, XLogP of 0.74, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methylbut-2-enoate is sourced from PubChem (CID 77074098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).