C12H22N2O2 — CID 77074623
4-[4-(dimethylamino)piperidin-1-yl]-2-methylbut-2-enoic acid (PubChem CID 77074623) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-[4-(dimethylamino)piperidin-1-yl]-2-methylbut-2-enoic acid.
| Compound Name | 4-[4-(dimethylamino)piperidin-1-yl]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 77074623 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 4-[4-(dimethylamino)piperidin-1-yl]-2-methylbut-2-enoic acid |
| SMILES | CC(=CCN1CCC(N(C)C)CC1)C(=O)O |
| InChI | InChI=1S/C12H22N2O2/c1-10(12(15)16)4-7-14-8-5-11(6-9-14)13(2)3/h4,11H,5-9H2,1-3H3,(H,15,16) |
| InChIKey | NPASSOIIPVUQLJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|