C11H9BrFNO5 — CID 77074661
4-(2-bromo-4-fluoro-6-nitrophenoxy)-2-methylbut-2-enoic acid (PubChem CID 77074661) has the molecular formula C11H9BrFNO5 and a molecular weight of 334.10 g/mol. Its IUPAC name is 4-(2-bromo-4-fluoro-6-nitrophenoxy)-2-methylbut-2-enoic acid.
| Compound Name | 4-(2-bromo-4-fluoro-6-nitrophenoxy)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 77074661 |
| Molecular Formula | C11H9BrFNO5 |
| Molecular Weight | 334.10 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 4-(2-bromo-4-fluoro-6-nitrophenoxy)-2-methylbut-2-enoic acid |
| SMILES | CC(=CCOc1c(Br)cc(F)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H9BrFNO5/c1-6(11(15)16)2-3-19-10-8(12)4-7(13)5-9(10)14(17)18/h2,4-5H,3H2,1H3,(H,15,16) |
| InChIKey | KPLLMLBNAMNNPO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.10 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|