methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate

C13H22N2O3 — CID 77074751

IUPACmethyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate
SMILESCOC(=O)C(C)=CCN1CCCN(C(C)=O)CC1
InChIInChI=1S/C13H22N2O3/c1-11(13(17)18-3)5-8-14-6-4-7-15(10-9-14)12(2)16/h5H,4,6-10H2,1-3H3
InChIKeyAVINMAAFPBXICD-UHFFFAOYSA-N
MW254.33 g/mol
LogP0.66
Rot. Bonds3

About methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate

methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate (PubChem CID 77074751) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate.

Molecular Properties

Compound Namemethyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate
PubChem CID77074751
Molecular FormulaC13H22N2O3
Molecular Weight254.33 g/mol
Exact Mass254.16
IUPAC Namemethyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate
SMILESCOC(=O)C(C)=CCN1CCCN(C(C)=O)CC1
InChIInChI=1S/C13H22N2O3/c1-11(13(17)18-3)5-8-14-6-4-7-15(10-9-14)12(2)16/h5H,4,6-10H2,1-3H3
InChIKeyAVINMAAFPBXICD-UHFFFAOYSA-N
XLogP0.66
TPSA49.85 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.33
LogP ≤ 50.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate?
The IUPAC name of methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate (CID 77074751) is methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate.
What is the SMILES notation for methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate?
The canonical SMILES for methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate is COC(=O)C(C)=CCN1CCCN(C(C)=O)CC1.
What is the InChIKey of methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate?
The InChIKey is AVINMAAFPBXICD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3/c1-11(13(17)18-3)5-8-14-6-4-7-15(10-9-14)12(2)16/h5H,4,6-10H2,1-3H3.
What are the key properties of methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate?
methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate has a molecular weight of 254.33 g/mol, XLogP of 0.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-methylbut-2-enoate is sourced from PubChem (CID 77074751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).