C15H17N3O2 — CID 77075442
N-(1H-imidazol-5-ylmethyl)-3-(2-methoxy-5-methylphenyl)prop-2-enamide (PubChem CID 77075442) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-3-(2-methoxy-5-methylphenyl)prop-2-enamide.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-3-(2-methoxy-5-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 77075442 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-3-(2-methoxy-5-methylphenyl)prop-2-enamide |
| SMILES | COc1ccc(C)cc1C=CC(=O)NCc1cnc[nH]1 |
| InChI | InChI=1S/C15H17N3O2/c1-11-3-5-14(20-2)12(7-11)4-6-15(19)17-9-13-8-16-10-18-13/h3-8,10H,9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | FYXSNCMNSIWMCM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|