C9H13ClN4O — CID 77075569
2-[(3-chloro-4-pyridinyl)methyl-methylamino]-N'-hydroxyethanimidamide (PubChem CID 77075569) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 2-[(3-chloro-4-pyridinyl)methyl-methylamino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[(3-chloro-4-pyridinyl)methyl-methylamino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77075569 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-[(3-chloro-4-pyridinyl)methyl-methylamino]-N'-hydroxyethanimidamide |
| SMILES | CN(CC(N)=NO)Cc1ccncc1Cl |
| InChI | InChI=1S/C9H13ClN4O/c1-14(6-9(11)13-15)5-7-2-3-12-4-8(7)10/h2-4,15H,5-6H2,1H3,(H2,11,13) |
| InChIKey | BJPHIVMXHDUYOA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|