About methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate
methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate (PubChem CID 77075805) has the molecular formula C11H16N2O4
and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate |
| PubChem CID | 77075805 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C11H16N2O4/c1-7(8(14)17-4)5-6-13-9(15)11(2,3)12-10(13)16/h5H,6H2,1-4H3,(H,12,16) |
| InChIKey | AJTWEGUSEHOUPZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate?
The IUPAC name of methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate (CID 77075805) is methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate.
What is the SMILES notation for methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate?
The canonical SMILES for methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate is COC(=O)C(C)=CCN1C(=O)NC(C)(C)C1=O.
What is the InChIKey of methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate?
The InChIKey is AJTWEGUSEHOUPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-7(8(14)17-4)5-6-13-9(15)11(2,3)12-10(13)16/h5H,6H2,1-4H3,(H,12,16).
What are the key properties of methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate?
methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate has a molecular weight of 240.26 g/mol, XLogP of 0.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-methylbut-2-enoate is sourced from PubChem (CID 77075805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).