C13H23NS — CID 7707597
(4aS,5aS,9aR,10aR)-10-methyl-1,2,3,4,4a,5a,6,7,8,9,9a,10a-dodecahydrophenothiazine (PubChem CID 7707597) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is (4aS,5aS,9aR,10aR)-10-methyl-1,2,3,4,4a,5a,6,7,8,9,9a,10a-dodecahydrophenothiazine.
| Compound Name | (4aS,5aS,9aR,10aR)-10-methyl-1,2,3,4,4a,5a,6,7,8,9,9a,10a-dodecahydrophenothiazine |
|---|---|
| PubChem CID | 7707597 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | (4aS,5aS,9aR,10aR)-10-methyl-1,2,3,4,4a,5a,6,7,8,9,9a,10a-dodecahydrophenothiazine |
| SMILES | CN1[C@@H]2CCCC[C@@H]2S[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C13H23NS/c1-14-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14/h10-13H,2-9H2,1H3/t10-,11-,12+,13+/m1/s1 |
| InChIKey | LMQISICJISWBIV-NDBYEHHHSA-N |
| XLogP | 3.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |