C22H23Cl2N3O — CID 7707731
(10bR)-2-(2,4-dichlorophenyl)-1',9-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine] (PubChem CID 7707731) has the molecular formula C22H23Cl2N3O and a molecular weight of 416.35 g/mol. Its IUPAC name is (10bR)-2-(2,4-dichlorophenyl)-1',9-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine].
| Compound Name | (10bR)-2-(2,4-dichlorophenyl)-1',9-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine] |
|---|---|
| PubChem CID | 7707731 |
| Molecular Formula | C22H23Cl2N3O |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (10bR)-2-(2,4-dichlorophenyl)-1',9-dimethylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine] |
| SMILES | Cc1ccc2c(c1)[C@H]1CC(c3ccc(Cl)cc3Cl)=NN1C1(CCN(C)CC1)O2 |
| InChI | InChI=1S/C22H23Cl2N3O/c1-14-3-6-21-17(11-14)20-13-19(16-5-4-15(23)12-18(16)24)25-27(20)22(28-21)7-9-26(2)10-8-22/h3-6,11-12,20H,7-10,13H2,1-2H3/t20-/m1/s1 |
| InChIKey | SAOVAMPHQMDJNU-HXUWFJFHSA-N |
| XLogP | 5.27 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |