C26H34F4N4O7S — CID 77078386
(2,3,5,6-tetrafluorophenyl) 3-[2-[3-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethylamino]-3-oxopropoxy]ethoxy]propanoate (PubChem CID 77078386) has the molecular formula C26H34F4N4O7S and a molecular weight of 622.64 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethylamino]-3-oxopropoxy]ethoxy]propanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethylamino]-3-oxopropoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 77078386 |
| Molecular Formula | C26H34F4N4O7S |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethylamino]-3-oxopropoxy]ethoxy]propanoate |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)NCCNC(=O)CCOCCOCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C26H34F4N4O7S/c27-15-13-16(28)23(30)25(22(15)29)41-21(37)6-10-40-12-11-39-9-5-20(36)32-8-7-31-19(35)4-2-1-3-18-24-17(14-42-18)33-26(38)34-24/h13,17-18,24H,1-12,14H2,(H,31,35)(H,32,36)(H2,33,34,38)/t17-,18-,24-/m0/s1 |
| InChIKey | JQYPTNZYNZCMGB-XFAGBWLFSA-N |
| XLogP | 1.92 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|