C13H18ClN5O2S — CID 77078858
4-[(4-chloro-1-methylindazol-3-yl)methyl]piperazine-1-sulfonamide (PubChem CID 77078858) has the molecular formula C13H18ClN5O2S and a molecular weight of 343.84 g/mol. Its IUPAC name is 4-[(4-chloro-1-methylindazol-3-yl)methyl]piperazine-1-sulfonamide.
| Compound Name | 4-[(4-chloro-1-methylindazol-3-yl)methyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 77078858 |
| Molecular Formula | C13H18ClN5O2S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-[(4-chloro-1-methylindazol-3-yl)methyl]piperazine-1-sulfonamide |
| SMILES | Cn1nc(CN2CCN(S(N)(=O)=O)CC2)c2c(Cl)cccc21 |
| InChI | InChI=1S/C13H18ClN5O2S/c1-17-12-4-2-3-10(14)13(12)11(16-17)9-18-5-7-19(8-6-18)22(15,20)21/h2-4H,5-9H2,1H3,(H2,15,20,21) |
| InChIKey | YUCSGDYGABNTQG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |