About 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide
1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide (PubChem CID 77079324) has the molecular formula C18H30N2O2
and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide |
| PubChem CID | 77079324 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1ccc(C(C)C)n(C)c1=O |
| InChI | InChI=1S/C18H30N2O2/c1-12(2)10-20(11-13(3)4)18(22)15-8-9-16(14(5)6)19(7)17(15)21/h8-9,12-14H,10-11H2,1-7H3 |
| InChIKey | ZHEMRJQGRMYIAU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide?
The IUPAC name of 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide (CID 77079324) is 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide.
What is the SMILES notation for 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide?
The canonical SMILES for 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide is CC(C)CN(CC(C)C)C(=O)c1ccc(C(C)C)n(C)c1=O.
What is the InChIKey of 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide?
The InChIKey is ZHEMRJQGRMYIAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O2/c1-12(2)10-20(11-13(3)4)18(22)15-8-9-16(14(5)6)19(7)17(15)21/h8-9,12-14H,10-11H2,1-7H3.
What are the key properties of 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide?
1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide has a molecular weight of 306.45 g/mol, XLogP of 3.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N,N-bis(2-methylpropyl)-2-oxo-6-propan-2-ylpyridine-3-carboxamide is sourced from PubChem (CID 77079324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).