About 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine
3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine (PubChem CID 77079592) has the molecular formula C17H19N5
and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine.
Molecular Properties
| Compound Name | 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine |
| PubChem CID | 77079592 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine |
| SMILES | CNc1nccnc1-c1ccc(C)cc1-n1nc(C)cc1C |
| InChI | InChI=1S/C17H19N5/c1-11-5-6-14(16-17(18-4)20-8-7-19-16)15(9-11)22-13(3)10-12(2)21-22/h5-10H,1-4H3,(H,18,20) |
| InChIKey | DSCDIIHNOCYDSZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine?
The IUPAC name of 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine (CID 77079592) is 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine.
What is the SMILES notation for 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine?
The canonical SMILES for 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine is CNc1nccnc1-c1ccc(C)cc1-n1nc(C)cc1C.
What is the InChIKey of 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine?
The InChIKey is DSCDIIHNOCYDSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5/c1-11-5-6-14(16-17(18-4)20-8-7-19-16)15(9-11)22-13(3)10-12(2)21-22/h5-10H,1-4H3,(H,18,20).
What are the key properties of 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine?
3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine has a molecular weight of 293.37 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,5-dimethylpyrazol-1-yl)-4-methylphenyl]-N-methylpyrazin-2-amine is sourced from PubChem (CID 77079592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).