About 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine
1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine (PubChem CID 77080429) has the molecular formula C12H22N4O2S
and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine.
Molecular Properties
| Compound Name | 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine |
| PubChem CID | 77080429 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine |
| SMILES | CCn1ncnc1CN1CCCC(CS(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H22N4O2S/c1-3-16-12(13-10-14-16)8-15-6-4-5-11(7-15)9-19(2,17)18/h10-11H,3-9H2,1-2H3 |
| InChIKey | PZZOQMDWIGKTSN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine?
The IUPAC name of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine (CID 77080429) is 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine.
What is the SMILES notation for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine?
The canonical SMILES for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine is CCn1ncnc1CN1CCCC(CS(C)(=O)=O)C1.
What is the InChIKey of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine?
The InChIKey is PZZOQMDWIGKTSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O2S/c1-3-16-12(13-10-14-16)8-15-6-4-5-11(7-15)9-19(2,17)18/h10-11H,3-9H2,1-2H3.
What are the key properties of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine?
1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine has a molecular weight of 286.40 g/mol, XLogP of 0.55, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-(methylsulfonylmethyl)piperidine is sourced from PubChem (CID 77080429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).