C16H15ClN6O2 — CID 77080620
3-chloro-6-methyl-N-[2-(pyridine-3-carbonylamino)ethyl]pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 77080620) has the molecular formula C16H15ClN6O2 and a molecular weight of 358.79 g/mol. Its IUPAC name is 3-chloro-6-methyl-N-[2-(pyridine-3-carbonylamino)ethyl]pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 3-chloro-6-methyl-N-[2-(pyridine-3-carbonylamino)ethyl]pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 77080620 |
| Molecular Formula | C16H15ClN6O2 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 3-chloro-6-methyl-N-[2-(pyridine-3-carbonylamino)ethyl]pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cnc2c(Cl)c(C(=O)NCCNC(=O)c3cccnc3)nn2c1 |
| InChI | InChI=1S/C16H15ClN6O2/c1-10-7-21-14-12(17)13(22-23(14)9-10)16(25)20-6-5-19-15(24)11-3-2-4-18-8-11/h2-4,7-9H,5-6H2,1H3,(H,19,24)(H,20,25) |
| InChIKey | XFUDOFABPVMFJW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|