C15H17N3O3S — CID 77081258
1-(furan-2-yl)-2-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]ethane-1,2-dione (PubChem CID 77081258) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(furan-2-yl)-2-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 77081258 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-(furan-2-yl)-2-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]ethane-1,2-dione |
| SMILES | Cc1nc(CN2CCN(C(=O)C(=O)c3ccco3)CC2)cs1 |
| InChI | InChI=1S/C15H17N3O3S/c1-11-16-12(10-22-11)9-17-4-6-18(7-5-17)15(20)14(19)13-3-2-8-21-13/h2-3,8,10H,4-7,9H2,1H3 |
| InChIKey | WTXOYCCSTASADR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|