C16H18ClN5 — CID 77081383
8-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 77081383) has the molecular formula C16H18ClN5 and a molecular weight of 315.81 g/mol. Its IUPAC name is 8-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 77081383 |
| Molecular Formula | C16H18ClN5 |
| Molecular Weight | 315.81 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 8-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | CCn1ncnc1CN1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C16H18ClN5/c1-2-22-16(18-10-19-22)9-21-6-5-15-13(8-21)12-7-11(17)3-4-14(12)20-15/h3-4,7,10,20H,2,5-6,8-9H2,1H3 |
| InChIKey | JVSFFPIURVNXBW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|