About N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine
N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine (PubChem CID 77082053) has the molecular formula C16H15N5O2S
and a molecular weight of 341.40 g/mol. Its IUPAC name is N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine.
Molecular Properties
| Compound Name | N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine |
| PubChem CID | 77082053 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine |
| SMILES | c1cc(-c2ccc(CN(Cc3cocn3)Cc3cocn3)s2)[nH]n1 |
| InChI | InChI=1S/C16H15N5O2S/c1-2-16(15-3-4-19-20-15)24-14(1)7-21(5-12-8-22-10-17-12)6-13-9-23-11-18-13/h1-4,8-11H,5-7H2,(H,19,20) |
| InChIKey | MUUUACCCOZKZNQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine?
The IUPAC name of N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine (CID 77082053) is N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine.
What is the SMILES notation for N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine?
The canonical SMILES for N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine is c1cc(-c2ccc(CN(Cc3cocn3)Cc3cocn3)s2)[nH]n1.
What is the InChIKey of N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine?
The InChIKey is MUUUACCCOZKZNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O2S/c1-2-16(15-3-4-19-20-15)24-14(1)7-21(5-12-8-22-10-17-12)6-13-9-23-11-18-13/h1-4,8-11H,5-7H2,(H,19,20).
What are the key properties of N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine?
N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine has a molecular weight of 341.40 g/mol, XLogP of 3.32, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(1,3-oxazol-4-ylmethyl)-1-[5-(1H-pyrazol-5-yl)thiophen-2-yl]methanamine is sourced from PubChem (CID 77082053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).