About 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol
2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol (PubChem CID 77082676) has the molecular formula C15H25N5O
and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol |
| PubChem CID | 77082676 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol |
| SMILES | Cc1nn(CCO)c(C)c1CN(C)CCn1ccnc1C |
| InChI | InChI=1S/C15H25N5O/c1-12-15(13(2)20(17-12)9-10-21)11-18(4)7-8-19-6-5-16-14(19)3/h5-6,21H,7-11H2,1-4H3 |
| InChIKey | CHTZBXBBGVLYSA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol?
The IUPAC name of 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol (CID 77082676) is 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol.
What is the SMILES notation for 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol?
The canonical SMILES for 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol is Cc1nn(CCO)c(C)c1CN(C)CCn1ccnc1C.
What is the InChIKey of 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol?
The InChIKey is CHTZBXBBGVLYSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N5O/c1-12-15(13(2)20(17-12)9-10-21)11-18(4)7-8-19-6-5-16-14(19)3/h5-6,21H,7-11H2,1-4H3.
What are the key properties of 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol?
2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol has a molecular weight of 291.40 g/mol, XLogP of 1.13, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dimethyl-4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]pyrazol-1-yl]ethanol is sourced from PubChem (CID 77082676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).