About 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine
1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine (PubChem CID 77082730) has the molecular formula C14H18ClF2NO2
and a molecular weight of 305.75 g/mol. Its IUPAC name is 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine.
Molecular Properties
| Compound Name | 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine |
| PubChem CID | 77082730 |
| Molecular Formula | C14H18ClF2NO2 |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine |
| SMILES | COc1cc(OC)c(CN2CCC(F)(F)CC2)cc1Cl |
| InChI | InChI=1S/C14H18ClF2NO2/c1-19-12-8-13(20-2)11(15)7-10(12)9-18-5-3-14(16,17)4-6-18/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | UIECIBYJVOQVJW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine?
The IUPAC name of 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine (CID 77082730) is 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine.
What is the SMILES notation for 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine?
The canonical SMILES for 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine is COc1cc(OC)c(CN2CCC(F)(F)CC2)cc1Cl.
What is the InChIKey of 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine?
The InChIKey is UIECIBYJVOQVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClF2NO2/c1-19-12-8-13(20-2)11(15)7-10(12)9-18-5-3-14(16,17)4-6-18/h7-8H,3-6,9H2,1-2H3.
What are the key properties of 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine?
1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine has a molecular weight of 305.75 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4,4-difluoropiperidine is sourced from PubChem (CID 77082730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).