C18H21N3O4S — CID 77083145
N-methyl-3-(4-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide (PubChem CID 77083145) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-methyl-3-(4-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide.
| Compound Name | N-methyl-3-(4-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 77083145 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-methyl-3-(4-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
| SMILES | CC1=CCN(C(=O)c2cccc(S(=O)(=O)N(C)Cc3ccon3)c2)CC1 |
| InChI | InChI=1S/C18H21N3O4S/c1-14-6-9-21(10-7-14)18(22)15-4-3-5-17(12-15)26(23,24)20(2)13-16-8-11-25-19-16/h3-6,8,11-12H,7,9-10,13H2,1-2H3 |
| InChIKey | LDWGWFFWIYSRAI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|