C16H21N3O — CID 77083170
3-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]propanamide (PubChem CID 77083170) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]propanamide.
| Compound Name | 3-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 77083170 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 3-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]propanamide |
| SMILES | N#Cc1cccc(CN2CCC(CCC(N)=O)CC2)c1 |
| InChI | InChI=1S/C16H21N3O/c17-11-14-2-1-3-15(10-14)12-19-8-6-13(7-9-19)4-5-16(18)20/h1-3,10,13H,4-9,12H2,(H2,18,20) |
| InChIKey | MHTGKUAJINALHM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |