About N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine
N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine (PubChem CID 77083518) has the molecular formula C18H27N5
and a molecular weight of 313.45 g/mol. Its IUPAC name is N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine |
| PubChem CID | 77083518 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine |
| SMILES | Cc1cnn(C)c1CN(Cc1ccncc1)C1CCN(C)CC1 |
| InChI | InChI=1S/C18H27N5/c1-15-12-20-22(3)18(15)14-23(13-16-4-8-19-9-5-16)17-6-10-21(2)11-7-17/h4-5,8-9,12,17H,6-7,10-11,13-14H2,1-3H3 |
| InChIKey | OAVVELHNHXQNIT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine?
The IUPAC name of N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine (CID 77083518) is N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine.
What is the SMILES notation for N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine?
The canonical SMILES for N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine is Cc1cnn(C)c1CN(Cc1ccncc1)C1CCN(C)CC1.
What is the InChIKey of N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine?
The InChIKey is OAVVELHNHXQNIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N5/c1-15-12-20-22(3)18(15)14-23(13-16-4-8-19-9-5-16)17-6-10-21(2)11-7-17/h4-5,8-9,12,17H,6-7,10-11,13-14H2,1-3H3.
What are the key properties of N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine?
N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine has a molecular weight of 313.45 g/mol, XLogP of 2.22, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,4-dimethylpyrazol-5-yl)methyl]-1-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine is sourced from PubChem (CID 77083518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).