About 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol
1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol (PubChem CID 77083562) has the molecular formula C20H23ClFNO3
and a molecular weight of 379.86 g/mol. Its IUPAC name is 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol |
| PubChem CID | 77083562 |
| Molecular Formula | C20H23ClFNO3 |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol |
| SMILES | COc1cc(OC)c(CN2CCC(O)(c3ccc(F)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C20H23ClFNO3/c1-25-18-12-19(26-2)17(21)11-14(18)13-23-9-7-20(24,8-10-23)15-3-5-16(22)6-4-15/h3-6,11-12,24H,7-10,13H2,1-2H3 |
| InChIKey | WYERVJJJHJENDG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol?
The IUPAC name of 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol (CID 77083562) is 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol.
What is the SMILES notation for 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol?
The canonical SMILES for 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol is COc1cc(OC)c(CN2CCC(O)(c3ccc(F)cc3)CC2)cc1Cl.
What is the InChIKey of 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol?
The InChIKey is WYERVJJJHJENDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23ClFNO3/c1-25-18-12-19(26-2)17(21)11-14(18)13-23-9-7-20(24,8-10-23)15-3-5-16(22)6-4-15/h3-6,11-12,24H,7-10,13H2,1-2H3.
What are the key properties of 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol?
1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol has a molecular weight of 379.86 g/mol, XLogP of 3.98, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-2,4-dimethoxyphenyl)methyl]-4-(4-fluorophenyl)piperidin-4-ol is sourced from PubChem (CID 77083562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).