About 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide
5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide (PubChem CID 77083824) has the molecular formula C15H19N3O3S
and a molecular weight of 321.40 g/mol. Its IUPAC name is 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide.
Molecular Properties
| Compound Name | 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide |
| PubChem CID | 77083824 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide |
| SMILES | CCc1nnc(CN(C(=O)c2csc(C(C)=O)c2)C(C)C)o1 |
| InChI | InChI=1S/C15H19N3O3S/c1-5-13-16-17-14(21-13)7-18(9(2)3)15(20)11-6-12(10(4)19)22-8-11/h6,8-9H,5,7H2,1-4H3 |
| InChIKey | KZSPFLWFLVZQOL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide?
The IUPAC name of 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide (CID 77083824) is 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide.
What is the SMILES notation for 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide?
The canonical SMILES for 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide is CCc1nnc(CN(C(=O)c2csc(C(C)=O)c2)C(C)C)o1.
What is the InChIKey of 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide?
The InChIKey is KZSPFLWFLVZQOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3S/c1-5-13-16-17-14(21-13)7-18(9(2)3)15(20)11-6-12(10(4)19)22-8-11/h6,8-9H,5,7H2,1-4H3.
What are the key properties of 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide?
5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide has a molecular weight of 321.40 g/mol, XLogP of 2.95, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylthiophene-3-carboxamide is sourced from PubChem (CID 77083824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).