C17H22N2OS — CID 77084236
N-methyl-N-(2-methylsulfanylethyl)-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide (PubChem CID 77084236) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is N-methyl-N-(2-methylsulfanylethyl)-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide.
| Compound Name | N-methyl-N-(2-methylsulfanylethyl)-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide |
|---|---|
| PubChem CID | 77084236 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-methyl-N-(2-methylsulfanylethyl)-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide |
| SMILES | CSCCN(C)C(=O)c1ccc2c3c([nH]c2c1)CCCC3 |
| InChI | InChI=1S/C17H22N2OS/c1-19(9-10-21-2)17(20)12-7-8-14-13-5-3-4-6-15(13)18-16(14)11-12/h7-8,11,18H,3-6,9-10H2,1-2H3 |
| InChIKey | RUUIMLYXRHQYEA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|