C14H23N3O2 — CID 77084654
4-hydroxy-N-[1-(5-methyl-1H-imidazol-2-yl)propyl]cyclohexane-1-carboxamide (PubChem CID 77084654) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-hydroxy-N-[1-(5-methyl-1H-imidazol-2-yl)propyl]cyclohexane-1-carboxamide.
| Compound Name | 4-hydroxy-N-[1-(5-methyl-1H-imidazol-2-yl)propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 77084654 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-hydroxy-N-[1-(5-methyl-1H-imidazol-2-yl)propyl]cyclohexane-1-carboxamide |
| SMILES | CCC(NC(=O)C1CCC(O)CC1)c1ncc(C)[nH]1 |
| InChI | InChI=1S/C14H23N3O2/c1-3-12(13-15-8-9(2)16-13)17-14(19)10-4-6-11(18)7-5-10/h8,10-12,18H,3-7H2,1-2H3,(H,15,16)(H,17,19) |
| InChIKey | PFYCKIDCRGTSDB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |