C20H29N5O — CID 77086654
1-[1-methyl-5-[[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methyl]pyrrol-3-yl]ethanone (PubChem CID 77086654) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 1-[1-methyl-5-[[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methyl]pyrrol-3-yl]ethanone.
| Compound Name | 1-[1-methyl-5-[[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methyl]pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 77086654 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 1-[1-methyl-5-[[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methyl]pyrrol-3-yl]ethanone |
| SMILES | CC(=O)c1cc(CN2CCC(c3nnc4n3CCCCC4)CC2)n(C)c1 |
| InChI | InChI=1S/C20H29N5O/c1-15(26)17-12-18(23(2)13-17)14-24-10-7-16(8-11-24)20-22-21-19-6-4-3-5-9-25(19)20/h12-13,16H,3-11,14H2,1-2H3 |
| InChIKey | AOGXHCKUWSIYFT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |