C17H22ClN5 — CID 77087625
1-(5-chloro-3-methyl-1H-indol-2-yl)-N-methyl-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]methanamine (PubChem CID 77087625) has the molecular formula C17H22ClN5 and a molecular weight of 331.85 g/mol. Its IUPAC name is 1-(5-chloro-3-methyl-1H-indol-2-yl)-N-methyl-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]methanamine.
| Compound Name | 1-(5-chloro-3-methyl-1H-indol-2-yl)-N-methyl-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]methanamine |
|---|---|
| PubChem CID | 77087625 |
| Molecular Formula | C17H22ClN5 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-(5-chloro-3-methyl-1H-indol-2-yl)-N-methyl-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]methanamine |
| SMILES | CCCn1cnnc1CN(C)Cc1[nH]c2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C17H22ClN5/c1-4-7-23-11-19-21-17(23)10-22(3)9-16-12(2)14-8-13(18)5-6-15(14)20-16/h5-6,8,11,20H,4,7,9-10H2,1-3H3 |
| InChIKey | DEMJTOSHBYNXMQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|