C20H27N3O2 — CID 77087648
(3aR,5R,6S,7aS)-2-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol (PubChem CID 77087648) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (3aR,5R,6S,7aS)-2-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol.
| Compound Name | (3aR,5R,6S,7aS)-2-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
|---|---|
| PubChem CID | 77087648 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (3aR,5R,6S,7aS)-2-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
| SMILES | Cc1cc(C)n(-c2cccc(CN3C[C@H]4C[C@H](O)[C@H](O)C[C@H]4C3)c2)n1 |
| InChI | InChI=1S/C20H27N3O2/c1-13-6-14(2)23(21-13)18-5-3-4-15(7-18)10-22-11-16-8-19(24)20(25)9-17(16)12-22/h3-7,16-17,19-20,24-25H,8-12H2,1-2H3/t16-,17+,19+,20- |
| InChIKey | SLVCORGMJROHLT-KJWXAFIESA-N |
| XLogP | 2.05 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |