C15H19N5S — CID 77088431
N-methyl-2-(1-methylpyrazol-4-yl)-N-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]ethanamine (PubChem CID 77088431) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is N-methyl-2-(1-methylpyrazol-4-yl)-N-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]ethanamine.
| Compound Name | N-methyl-2-(1-methylpyrazol-4-yl)-N-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 77088431 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-methyl-2-(1-methylpyrazol-4-yl)-N-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]ethanamine |
| SMILES | CN(CCc1cnn(C)c1)Cc1ccc(-c2ccn[nH]2)s1 |
| InChI | InChI=1S/C15H19N5S/c1-19(8-6-12-9-17-20(2)10-12)11-13-3-4-15(21-13)14-5-7-16-18-14/h3-5,7,9-10H,6,8,11H2,1-2H3,(H,16,18) |
| InChIKey | FHAIYIPMTYEXQR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |