C18H20N4O2 — CID 77088501
2-(1,2-benzoxazol-3-yl)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)acetamide (PubChem CID 77088501) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)acetamide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 77088501 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)acetamide |
| SMILES | O=C(Cc1noc2ccccc12)NCc1n[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C18H20N4O2/c23-18(10-15-13-7-4-5-9-17(13)24-22-15)19-11-16-12-6-2-1-3-8-14(12)20-21-16/h4-5,7,9H,1-3,6,8,10-11H2,(H,19,23)(H,20,21) |
| InChIKey | JWSUDYKONPXHRE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |