C19H28F3N3O — CID 77088709
1-methyl-4-[[1-[[2-(trifluoromethoxy)phenyl]methyl]piperidin-3-yl]methyl]piperazine (PubChem CID 77088709) has the molecular formula C19H28F3N3O and a molecular weight of 371.45 g/mol. Its IUPAC name is 1-methyl-4-[[1-[[2-(trifluoromethoxy)phenyl]methyl]piperidin-3-yl]methyl]piperazine.
| Compound Name | 1-methyl-4-[[1-[[2-(trifluoromethoxy)phenyl]methyl]piperidin-3-yl]methyl]piperazine |
|---|---|
| PubChem CID | 77088709 |
| Molecular Formula | C19H28F3N3O |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-methyl-4-[[1-[[2-(trifluoromethoxy)phenyl]methyl]piperidin-3-yl]methyl]piperazine |
| SMILES | CN1CCN(CC2CCCN(Cc3ccccc3OC(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C19H28F3N3O/c1-23-9-11-24(12-10-23)13-16-5-4-8-25(14-16)15-17-6-2-3-7-18(17)26-19(20,21)22/h2-3,6-7,16H,4-5,8-15H2,1H3 |
| InChIKey | QOLLJRGAIANNPW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |