C14H14N6O4 — CID 77088867
2-(2,4-dioxoimidazolidin-1-yl)-N-[1-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)ethyl]acetamide (PubChem CID 77088867) has the molecular formula C14H14N6O4 and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-(2,4-dioxoimidazolidin-1-yl)-N-[1-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)ethyl]acetamide.
| Compound Name | 2-(2,4-dioxoimidazolidin-1-yl)-N-[1-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 77088867 |
| Molecular Formula | C14H14N6O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-(2,4-dioxoimidazolidin-1-yl)-N-[1-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN1CC(=O)NC1=O)c1nc(-c2ccncc2)no1 |
| InChI | InChI=1S/C14H14N6O4/c1-8(16-10(21)6-20-7-11(22)17-14(20)23)13-18-12(19-24-13)9-2-4-15-5-3-9/h2-5,8H,6-7H2,1H3,(H,16,21)(H,17,22,23) |
| InChIKey | QCCZASQGILRONV-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 130.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|