C17H23NO4 — CID 77089115
2-(4-acetylphenoxy)-N-[2-(oxan-2-yl)ethyl]acetamide (PubChem CID 77089115) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-(4-acetylphenoxy)-N-[2-(oxan-2-yl)ethyl]acetamide.
| Compound Name | 2-(4-acetylphenoxy)-N-[2-(oxan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 77089115 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-(4-acetylphenoxy)-N-[2-(oxan-2-yl)ethyl]acetamide |
| SMILES | CC(=O)c1ccc(OCC(=O)NCCC2CCCCO2)cc1 |
| InChI | InChI=1S/C17H23NO4/c1-13(19)14-5-7-16(8-6-14)22-12-17(20)18-10-9-15-4-2-3-11-21-15/h5-8,15H,2-4,9-12H2,1H3,(H,18,20) |
| InChIKey | BWQJYBOTUIMJFW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |