C19H26FN3O2 — CID 77089234
1-(2-fluorophenyl)-2,2-dimethyl-N-[3-(3-oxopiperazin-1-yl)propyl]cyclopropane-1-carboxamide (PubChem CID 77089234) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2,2-dimethyl-N-[3-(3-oxopiperazin-1-yl)propyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-2,2-dimethyl-N-[3-(3-oxopiperazin-1-yl)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 77089234 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-(2-fluorophenyl)-2,2-dimethyl-N-[3-(3-oxopiperazin-1-yl)propyl]cyclopropane-1-carboxamide |
| SMILES | CC1(C)CC1(C(=O)NCCCN1CCNC(=O)C1)c1ccccc1F |
| InChI | InChI=1S/C19H26FN3O2/c1-18(2)13-19(18,14-6-3-4-7-15(14)20)17(25)22-8-5-10-23-11-9-21-16(24)12-23/h3-4,6-7H,5,8-13H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | RBXGMHSNFKSOIW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|