C15H14N4O2S — CID 7708947
2-(4-methyl-10-oxo-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-8-yl)acetamide (PubChem CID 7708947) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-(4-methyl-10-oxo-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-8-yl)acetamide.
| Compound Name | 2-(4-methyl-10-oxo-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-8-yl)acetamide |
|---|---|
| PubChem CID | 7708947 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-(4-methyl-10-oxo-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-8-yl)acetamide |
| SMILES | Cc1ccc2c(c1)c1nc3n(c(=O)c1n2CC(N)=O)CCS3 |
| InChI | InChI=1S/C15H14N4O2S/c1-8-2-3-10-9(6-8)12-13(19(10)7-11(16)20)14(21)18-4-5-22-15(18)17-12/h2-3,6H,4-5,7H2,1H3,(H2,16,20) |
| InChIKey | IZBYFRNNDCUQQW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |