About N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide
N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide (PubChem CID 77089701) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide.
Molecular Properties
| Compound Name | N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide |
| PubChem CID | 77089701 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide |
| SMILES | Cc1nnc(CN(C)C(=O)CCc2cccnc2)o1 |
| InChI | InChI=1S/C13H16N4O2/c1-10-15-16-12(19-10)9-17(2)13(18)6-5-11-4-3-7-14-8-11/h3-4,7-8H,5-6,9H2,1-2H3 |
| InChIKey | XAWKJZDFNNRQGA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide?
The IUPAC name of N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide (CID 77089701) is N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide.
What is the SMILES notation for N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide?
The canonical SMILES for N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide is Cc1nnc(CN(C)C(=O)CCc2cccnc2)o1.
What is the InChIKey of N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide?
The InChIKey is XAWKJZDFNNRQGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c1-10-15-16-12(19-10)9-17(2)13(18)6-5-11-4-3-7-14-8-11/h3-4,7-8H,5-6,9H2,1-2H3.
What are the key properties of N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide?
N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide has a molecular weight of 260.30 g/mol, XLogP of 1.36, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-pyridin-3-ylpropanamide is sourced from PubChem (CID 77089701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).