About N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide
N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide (PubChem CID 77090336) has the molecular formula C14H25N3O2
and a molecular weight of 267.37 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide.
Molecular Properties
| Compound Name | N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide |
| PubChem CID | 77090336 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide |
| SMILES | Cc1n[nH]c(C)c1CCN(C)C(=O)C(O)CC(C)C |
| InChI | InChI=1S/C14H25N3O2/c1-9(2)8-13(18)14(19)17(5)7-6-12-10(3)15-16-11(12)4/h9,13,18H,6-8H2,1-5H3,(H,15,16) |
| InChIKey | XKADKMPIVMANKX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide?
The IUPAC name of N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide (CID 77090336) is N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide.
What is the SMILES notation for N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide?
The canonical SMILES for N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide is Cc1n[nH]c(C)c1CCN(C)C(=O)C(O)CC(C)C.
What is the InChIKey of N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide?
The InChIKey is XKADKMPIVMANKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O2/c1-9(2)8-13(18)14(19)17(5)7-6-12-10(3)15-16-11(12)4/h9,13,18H,6-8H2,1-5H3,(H,15,16).
What are the key properties of N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide?
N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide has a molecular weight of 267.37 g/mol, XLogP of 1.43, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-hydroxy-N,4-dimethylpentanamide is sourced from PubChem (CID 77090336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).