About 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide
6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide (PubChem CID 77091362) has the molecular formula C16H22N4O2
and a molecular weight of 302.38 g/mol. Its IUPAC name is 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide |
| PubChem CID | 77091362 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide |
| SMILES | CCc1c(C)cc(C(=O)N(C)CCn2cccn2)c(=O)n1C |
| InChI | InChI=1S/C16H22N4O2/c1-5-14-12(2)11-13(16(22)19(14)4)15(21)18(3)9-10-20-8-6-7-17-20/h6-8,11H,5,9-10H2,1-4H3 |
| InChIKey | GXMYZQOBTRPZSL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide?
The IUPAC name of 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide (CID 77091362) is 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide.
What is the SMILES notation for 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide?
The canonical SMILES for 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide is CCc1c(C)cc(C(=O)N(C)CCn2cccn2)c(=O)n1C.
What is the InChIKey of 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide?
The InChIKey is GXMYZQOBTRPZSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O2/c1-5-14-12(2)11-13(16(22)19(14)4)15(21)18(3)9-10-20-8-6-7-17-20/h6-8,11H,5,9-10H2,1-4H3.
What are the key properties of 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide?
6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide has a molecular weight of 302.38 g/mol, XLogP of 1.22, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-N,1,5-trimethyl-2-oxo-N-(2-pyrazol-1-ylethyl)pyridine-3-carboxamide is sourced from PubChem (CID 77091362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).