C24H29N3O — CID 77092346
1,4-dimethyl-N-[2-(3-phenylpiperidin-1-yl)ethyl]indole-2-carboxamide (PubChem CID 77092346) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 1,4-dimethyl-N-[2-(3-phenylpiperidin-1-yl)ethyl]indole-2-carboxamide.
| Compound Name | 1,4-dimethyl-N-[2-(3-phenylpiperidin-1-yl)ethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 77092346 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1,4-dimethyl-N-[2-(3-phenylpiperidin-1-yl)ethyl]indole-2-carboxamide |
| SMILES | Cc1cccc2c1cc(C(=O)NCCN1CCCC(c3ccccc3)C1)n2C |
| InChI | InChI=1S/C24H29N3O/c1-18-8-6-12-22-21(18)16-23(26(22)2)24(28)25-13-15-27-14-7-11-20(17-27)19-9-4-3-5-10-19/h3-6,8-10,12,16,20H,7,11,13-15,17H2,1-2H3,(H,25,28) |
| InChIKey | XCTOGMGHWQIHSQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |