C15H24N4 — CID 77092678
5-[[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-N,N-dimethylpyridin-2-amine (PubChem CID 77092678) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-[[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-N,N-dimethylpyridin-2-amine.
| Compound Name | 5-[[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 77092678 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 5-[[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-N,N-dimethylpyridin-2-amine |
| SMILES | CN1C[C@@H]2CN(Cc3ccc(N(C)C)nc3)C[C@@H]2C1 |
| InChI | InChI=1S/C15H24N4/c1-17(2)15-5-4-12(6-16-15)7-19-10-13-8-18(3)9-14(13)11-19/h4-6,13-14H,7-11H2,1-3H3/t13-,14+ |
| InChIKey | ULFWETDPJJXEFX-OKILXGFUSA-N |
| XLogP | 1.14 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |