C18H23N3O3 — CID 77092764
N-[(8-methoxyquinolin-5-yl)methyl]-N-methyl-2-morpholin-2-ylacetamide (PubChem CID 77092764) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[(8-methoxyquinolin-5-yl)methyl]-N-methyl-2-morpholin-2-ylacetamide.
| Compound Name | N-[(8-methoxyquinolin-5-yl)methyl]-N-methyl-2-morpholin-2-ylacetamide |
|---|---|
| PubChem CID | 77092764 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[(8-methoxyquinolin-5-yl)methyl]-N-methyl-2-morpholin-2-ylacetamide |
| SMILES | COc1ccc(CN(C)C(=O)CC2CNCCO2)c2cccnc12 |
| InChI | InChI=1S/C18H23N3O3/c1-21(17(22)10-14-11-19-8-9-24-14)12-13-5-6-16(23-2)18-15(13)4-3-7-20-18/h3-7,14,19H,8-12H2,1-2H3 |
| InChIKey | KUDLGXHBVQEGLV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |